C15H18O3 — CID 58248588
(E)-1-hydroxy-8-(4-methylphenyl)oct-7-ene-2,6-dione (PubChem CID 58248588) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (E)-1-hydroxy-8-(4-methylphenyl)oct-7-ene-2,6-dione.
| Compound Name | (E)-1-hydroxy-8-(4-methylphenyl)oct-7-ene-2,6-dione |
|---|---|
| PubChem CID | 58248588 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (E)-1-hydroxy-8-(4-methylphenyl)oct-7-ene-2,6-dione |
| SMILES | Cc1ccc(/C=C/C(=O)CCCC(=O)CO)cc1 |
| InChI | InChI=1S/C15H18O3/c1-12-5-7-13(8-6-12)9-10-14(17)3-2-4-15(18)11-16/h5-10,16H,2-4,11H2,1H3/b10-9+ |
| InChIKey | CVMHEFDNLBYJTK-MDZDMXLPSA-N |
| XLogP | 2.31 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|