C18H16Cl2O — CID 1474643
5-(2,6-dichlorophenyl)-1-(4-methylphenyl)pent-1-en-3-one (PubChem CID 1474643) has the molecular formula C18H16Cl2O and a molecular weight of 319.23 g/mol. Its IUPAC name is 5-(2,6-dichlorophenyl)-1-(4-methylphenyl)pent-1-en-3-one.
| Compound Name | 5-(2,6-dichlorophenyl)-1-(4-methylphenyl)pent-1-en-3-one |
|---|---|
| PubChem CID | 1474643 |
| Molecular Formula | C18H16Cl2O |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 5-(2,6-dichlorophenyl)-1-(4-methylphenyl)pent-1-en-3-one |
| SMILES | Cc1ccc(C=CC(=O)CCc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C18H16Cl2O/c1-13-5-7-14(8-6-13)9-10-15(21)11-12-16-17(19)3-2-4-18(16)20/h2-10H,11-12H2,1H3 |
| InChIKey | GLPJMWVOFMACHH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|