C13H16Cl2O — CID 43370354
1-(2,6-dichlorophenyl)-4,4-dimethylpentan-3-one (PubChem CID 43370354) has the molecular formula C13H16Cl2O and a molecular weight of 259.18 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-4,4-dimethylpentan-3-one.
| Compound Name | 1-(2,6-dichlorophenyl)-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 43370354 |
| Molecular Formula | C13H16Cl2O |
| Molecular Weight | 259.18 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-4,4-dimethylpentan-3-one |
| SMILES | CC(C)(C)C(=O)CCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H16Cl2O/c1-13(2,3)12(16)8-7-9-10(14)5-4-6-11(9)15/h4-6H,7-8H2,1-3H3 |
| InChIKey | TXUXOJMUTZTOOQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.18 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |