C9H8Cl3NO — CID 59264862
(1E)-3-(2,6-dichlorophenyl)-N-hydroxypropanimidoyl chloride (PubChem CID 59264862) has the molecular formula C9H8Cl3NO and a molecular weight of 252.53 g/mol. Its IUPAC name is (1E)-3-(2,6-dichlorophenyl)-N-hydroxypropanimidoyl chloride.
| Compound Name | (1E)-3-(2,6-dichlorophenyl)-N-hydroxypropanimidoyl chloride |
|---|---|
| PubChem CID | 59264862 |
| Molecular Formula | C9H8Cl3NO |
| Molecular Weight | 252.53 g/mol |
| Exact Mass | 250.97 |
| IUPAC Name | (1E)-3-(2,6-dichlorophenyl)-N-hydroxypropanimidoyl chloride |
| SMILES | O/N=C(/Cl)CCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H8Cl3NO/c10-7-2-1-3-8(11)6(7)4-5-9(12)13-14/h1-3,14H,4-5H2/b13-9+ |
| InChIKey | XLISHUGXFZVICG-UKTHLTGXSA-N |
| XLogP | 3.95 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|