C8H10Cl2N+ — CID 6951285
2-(2,6-dichlorophenyl)ethylazanium (PubChem CID 6951285) has the molecular formula C8H10Cl2N+ and a molecular weight of 191.08 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)ethylazanium.
| Compound Name | 2-(2,6-dichlorophenyl)ethylazanium |
|---|---|
| PubChem CID | 6951285 |
| Molecular Formula | C8H10Cl2N+ |
| Molecular Weight | 191.08 g/mol |
| Exact Mass | 190.02 |
| IUPAC Name | 2-(2,6-dichlorophenyl)ethylazanium |
| SMILES | [NH3+]CCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C8H9Cl2N/c9-7-2-1-3-8(10)6(7)4-5-11/h1-3H,4-5,11H2/p+1 |
| InChIKey | ACIMQXSSGMWVKG-UHFFFAOYSA-O |
| XLogP | 1.78 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.08 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |