C11H13BrCl2 — CID 64509594
2-(4-bromopentyl)-1,3-dichlorobenzene (PubChem CID 64509594) has the molecular formula C11H13BrCl2 and a molecular weight of 296.03 g/mol. Its IUPAC name is 2-(4-bromopentyl)-1,3-dichlorobenzene.
| Compound Name | 2-(4-bromopentyl)-1,3-dichlorobenzene |
|---|---|
| PubChem CID | 64509594 |
| Molecular Formula | C11H13BrCl2 |
| Molecular Weight | 296.03 g/mol |
| Exact Mass | 293.96 |
| IUPAC Name | 2-(4-bromopentyl)-1,3-dichlorobenzene |
| SMILES | CC(Br)CCCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H13BrCl2/c1-8(12)4-2-5-9-10(13)6-3-7-11(9)14/h3,6-8H,2,4-5H2,1H3 |
| InChIKey | VQFRYDNBDVAYDM-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.03 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|