C12H16Cl2S — CID 10777932
6-(2,6-dichlorophenyl)hexane-1-thiol (PubChem CID 10777932) has the molecular formula C12H16Cl2S and a molecular weight of 263.23 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)hexane-1-thiol.
| Compound Name | 6-(2,6-dichlorophenyl)hexane-1-thiol |
|---|---|
| PubChem CID | 10777932 |
| Molecular Formula | C12H16Cl2S |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 6-(2,6-dichlorophenyl)hexane-1-thiol |
| SMILES | SCCCCCCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H16Cl2S/c13-11-7-5-8-12(14)10(11)6-3-1-2-4-9-15/h5,7-8,15H,1-4,6,9H2 |
| InChIKey | BNRAHRIAAYNEHK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|