C14H10Cl4Se — CID 139083206
1,3-dichloro-2-[(2,6-dichlorophenyl)methylselanylmethyl]benzene (PubChem CID 139083206) has the molecular formula C14H10Cl4Se and a molecular weight of 399.01 g/mol. Its IUPAC name is 1,3-dichloro-2-[(2,6-dichlorophenyl)methylselanylmethyl]benzene.
| Compound Name | 1,3-dichloro-2-[(2,6-dichlorophenyl)methylselanylmethyl]benzene |
|---|---|
| PubChem CID | 139083206 |
| Molecular Formula | C14H10Cl4Se |
| Molecular Weight | 399.01 g/mol |
| Exact Mass | 397.87 |
| IUPAC Name | 1,3-dichloro-2-[(2,6-dichlorophenyl)methylselanylmethyl]benzene |
| SMILES | Clc1cccc(Cl)c1C[Se]Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H10Cl4Se/c15-11-3-1-4-12(16)9(11)7-19-8-10-13(17)5-2-6-14(10)18/h1-6H,7-8H2 |
| InChIKey | WAWIRPQKCDQSNP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.01 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|