C8H8Cl2N2 — CID 123418574
(2,6-dichlorophenyl)methyl-methyldiazene (PubChem CID 123418574) has the molecular formula C8H8Cl2N2 and a molecular weight of 203.07 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl-methyldiazene.
| Compound Name | (2,6-dichlorophenyl)methyl-methyldiazene |
|---|---|
| PubChem CID | 123418574 |
| Molecular Formula | C8H8Cl2N2 |
| Molecular Weight | 203.07 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | (2,6-dichlorophenyl)methyl-methyldiazene |
| SMILES | C/N=N/Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C8H8Cl2N2/c1-11-12-5-6-7(9)3-2-4-8(6)10/h2-4H,5H2,1H3/b12-11+ |
| InChIKey | ZBEHLLXTEQLULH-VAWYXSNFSA-N |
| XLogP | 3.58 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.07 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|