C7H5Cl2NO — CID 54118768
1,3-dichloro-2-(nitrosomethyl)benzene (PubChem CID 54118768) has the molecular formula C7H5Cl2NO and a molecular weight of 190.03 g/mol. Its IUPAC name is 1,3-dichloro-2-(nitrosomethyl)benzene.
| Compound Name | 1,3-dichloro-2-(nitrosomethyl)benzene |
|---|---|
| PubChem CID | 54118768 |
| Molecular Formula | C7H5Cl2NO |
| Molecular Weight | 190.03 g/mol |
| Exact Mass | 188.97 |
| IUPAC Name | 1,3-dichloro-2-(nitrosomethyl)benzene |
| SMILES | O=NCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C7H5Cl2NO/c8-6-2-1-3-7(9)5(6)4-10-11/h1-3H,4H2 |
| InChIKey | NMDYSTTUVYHTMQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.03 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |