C9H9Cl2N3O — CID 171391513
N-[bis(15N)(azanyl)(113C)methylidene]-2-(2,6-dichlorophenyl)acetamide (PubChem CID 171391513) has the molecular formula C9H9Cl2N3O and a molecular weight of 251.06 g/mol. Its IUPAC name is N-[bis(15N)(azanyl)(113C)methylidene]-2-(2,6-dichlorophenyl)acetamide.
| Compound Name | N-[bis(15N)(azanyl)(113C)methylidene]-2-(2,6-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 171391513 |
| Molecular Formula | C9H9Cl2N3O |
| Molecular Weight | 251.06 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | N-[bis(15N)(azanyl)(113C)methylidene]-2-(2,6-dichlorophenyl)acetamide |
| SMILES | [15NH2][13C]([15NH2])=[15N][13C](=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H9Cl2N3O/c10-6-2-1-3-7(11)5(6)4-8(15)14-9(12)13/h1-3H,4H2,(H4,12,13,14,15)/i8+1,9+1,12+1,13+1,14+1 |
| InChIKey | INJOMKTZOLKMBF-IQVLYLTESA-N |
| XLogP | 1.34 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.06 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|