C8H9Cl2N3 — CID 76923044
N'-amino-2-(2,6-dichlorophenyl)ethanimidamide (PubChem CID 76923044) has the molecular formula C8H9Cl2N3 and a molecular weight of 218.09 g/mol. Its IUPAC name is N'-amino-2-(2,6-dichlorophenyl)ethanimidamide.
| Compound Name | N'-amino-2-(2,6-dichlorophenyl)ethanimidamide |
|---|---|
| PubChem CID | 76923044 |
| Molecular Formula | C8H9Cl2N3 |
| Molecular Weight | 218.09 g/mol |
| Exact Mass | 217.02 |
| IUPAC Name | N'-amino-2-(2,6-dichlorophenyl)ethanimidamide |
| SMILES | NN=C(N)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C8H9Cl2N3/c9-6-2-1-3-7(10)5(6)4-8(11)13-12/h1-3H,4,12H2,(H2,11,13) |
| InChIKey | OZAQCARIMDXRGT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.09 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|