C9H10Cl2N2O — CID 12728425
2-(2,6-dichlorophenyl)-N'-methoxyethanimidamide (PubChem CID 12728425) has the molecular formula C9H10Cl2N2O and a molecular weight of 233.10 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-N'-methoxyethanimidamide.
| Compound Name | 2-(2,6-dichlorophenyl)-N'-methoxyethanimidamide |
|---|---|
| PubChem CID | 12728425 |
| Molecular Formula | C9H10Cl2N2O |
| Molecular Weight | 233.10 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-N'-methoxyethanimidamide |
| SMILES | CO/N=C(/N)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H10Cl2N2O/c1-14-13-9(12)5-6-7(10)3-2-4-8(6)11/h2-4H,5H2,1H3,(H2,12,13) |
| InChIKey | BYSARZNFRZDLFD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.10 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|