C13H14Cl2N2O3 — CID 87466621
methyl (2Z)-2-[[3-(2,6-dichlorophenyl)-2-oxopropyl]hydrazinylidene]propanoate (PubChem CID 87466621) has the molecular formula C13H14Cl2N2O3 and a molecular weight of 317.17 g/mol. Its IUPAC name is methyl (2Z)-2-[[3-(2,6-dichlorophenyl)-2-oxopropyl]hydrazinylidene]propanoate.
| Compound Name | methyl (2Z)-2-[[3-(2,6-dichlorophenyl)-2-oxopropyl]hydrazinylidene]propanoate |
|---|---|
| PubChem CID | 87466621 |
| Molecular Formula | C13H14Cl2N2O3 |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | methyl (2Z)-2-[[3-(2,6-dichlorophenyl)-2-oxopropyl]hydrazinylidene]propanoate |
| SMILES | COC(=O)/C(C)=N\NCC(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H14Cl2N2O3/c1-8(13(19)20-2)17-16-7-9(18)6-10-11(14)4-3-5-12(10)15/h3-5,16H,6-7H2,1-2H3/b17-8- |
| InChIKey | AIQINOJTAMXDTH-IUXPMGMMSA-N |
| XLogP | 2.24 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|