C8H8Cl3N2- — CID 45108783
2-(2,6-dichlorophenyl)ethanimidamide chloride (PubChem CID 45108783) has the molecular formula C8H8Cl3N2- and a molecular weight of 238.53 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)ethanimidamide chloride.
| Compound Name | 2-(2,6-dichlorophenyl)ethanimidamide chloride |
|---|---|
| PubChem CID | 45108783 |
| Molecular Formula | C8H8Cl3N2- |
| Molecular Weight | 238.53 g/mol |
| Exact Mass | 236.98 |
| IUPAC Name | 2-(2,6-dichlorophenyl)ethanimidamide chloride |
| SMILES | [Cl-].[H]/N=C(\N)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C8H8Cl2N2.ClH/c9-6-2-1-3-7(10)5(6)4-8(11)12;/h1-3H,4H2,(H3,11,12);1H/p-1 |
| InChIKey | YNPZJFKKDYCULJ-UHFFFAOYSA-M |
| XLogP | -0.52 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.53 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|