C15H11Cl4N3S — CID 74990545
1-[1-amino-2-(2,6-dichlorophenyl)ethylidene]-3-(2,4-dichlorophenyl)thiourea (PubChem CID 74990545) has the molecular formula C15H11Cl4N3S and a molecular weight of 407.15 g/mol. Its IUPAC name is 1-[1-amino-2-(2,6-dichlorophenyl)ethylidene]-3-(2,4-dichlorophenyl)thiourea.
| Compound Name | 1-[1-amino-2-(2,6-dichlorophenyl)ethylidene]-3-(2,4-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 74990545 |
| Molecular Formula | C15H11Cl4N3S |
| Molecular Weight | 407.15 g/mol |
| Exact Mass | 404.94 |
| IUPAC Name | 1-[1-amino-2-(2,6-dichlorophenyl)ethylidene]-3-(2,4-dichlorophenyl)thiourea |
| SMILES | NC(Cc1c(Cl)cccc1Cl)=NC(=S)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H11Cl4N3S/c16-8-4-5-13(12(19)6-8)21-15(23)22-14(20)7-9-10(17)2-1-3-11(9)18/h1-6H,7H2,(H3,20,21,22,23) |
| InChIKey | MHVKSENQEFUIBU-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.15 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|