C10H8Cl2N4S — CID 146506906
3-amino-N-(2,4-dichlorophenyl)pyrazole-1-carbothioamide (PubChem CID 146506906) has the molecular formula C10H8Cl2N4S and a molecular weight of 287.18 g/mol. Its IUPAC name is 3-amino-N-(2,4-dichlorophenyl)pyrazole-1-carbothioamide.
| Compound Name | 3-amino-N-(2,4-dichlorophenyl)pyrazole-1-carbothioamide |
|---|---|
| PubChem CID | 146506906 |
| Molecular Formula | C10H8Cl2N4S |
| Molecular Weight | 287.18 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 3-amino-N-(2,4-dichlorophenyl)pyrazole-1-carbothioamide |
| SMILES | Nc1ccn(C(=S)Nc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C10H8Cl2N4S/c11-6-1-2-8(7(12)5-6)14-10(17)16-4-3-9(13)15-16/h1-5H,(H2,13,15)(H,14,17) |
| InChIKey | FOORKLYIYCKCEN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.18 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|