C13H16Cl2N2OS — CID 2958699
N-(2,4-dichlorophenyl)-2-(hydroxymethyl)piperidine-1-carbothioamide (PubChem CID 2958699) has the molecular formula C13H16Cl2N2OS and a molecular weight of 319.26 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-(hydroxymethyl)piperidine-1-carbothioamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-(hydroxymethyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 2958699 |
| Molecular Formula | C13H16Cl2N2OS |
| Molecular Weight | 319.26 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-(hydroxymethyl)piperidine-1-carbothioamide |
| SMILES | OCC1CCCCN1C(=S)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H16Cl2N2OS/c14-9-4-5-12(11(15)7-9)16-13(19)17-6-2-1-3-10(17)8-18/h4-5,7,10,18H,1-3,6,8H2,(H,16,19) |
| InChIKey | FDURVZJKOGBLLJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.26 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|