C18H26ClN3OS — CID 134113677
N-(4-chlorophenyl)-2-(2-morpholin-4-ylethyl)piperidine-1-carbothioamide (PubChem CID 134113677) has the molecular formula C18H26ClN3OS and a molecular weight of 367.95 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(2-morpholin-4-ylethyl)piperidine-1-carbothioamide.
| Compound Name | N-(4-chlorophenyl)-2-(2-morpholin-4-ylethyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 134113677 |
| Molecular Formula | C18H26ClN3OS |
| Molecular Weight | 367.95 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-(4-chlorophenyl)-2-(2-morpholin-4-ylethyl)piperidine-1-carbothioamide |
| SMILES | S=C(Nc1ccc(Cl)cc1)N1CCCCC1CCN1CCOCC1 |
| InChI | InChI=1S/C18H26ClN3OS/c19-15-4-6-16(7-5-15)20-18(24)22-9-2-1-3-17(22)8-10-21-11-13-23-14-12-21/h4-7,17H,1-3,8-14H2,(H,20,24) |
| InChIKey | YRDICASOLPNVFY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.95 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|