C18H27FN3OS+ — CID 7176799
(2S)-N-(4-fluorophenyl)-2-(2-morpholin-4-ium-4-ylethyl)piperidine-1-carbothioamide (PubChem CID 7176799) has the molecular formula C18H27FN3OS+ and a molecular weight of 352.50 g/mol. Its IUPAC name is (2S)-N-(4-fluorophenyl)-2-(2-morpholin-4-ium-4-ylethyl)piperidine-1-carbothioamide.
| Compound Name | (2S)-N-(4-fluorophenyl)-2-(2-morpholin-4-ium-4-ylethyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 7176799 |
| Molecular Formula | C18H27FN3OS+ |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (2S)-N-(4-fluorophenyl)-2-(2-morpholin-4-ium-4-ylethyl)piperidine-1-carbothioamide |
| SMILES | Fc1ccc(NC(=S)N2CCCC[C@H]2CC[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C18H26FN3OS/c19-15-4-6-16(7-5-15)20-18(24)22-9-2-1-3-17(22)8-10-21-11-13-23-14-12-21/h4-7,17H,1-3,8-14H2,(H,20,24)/p+1/t17-/m0/s1 |
| InChIKey | AOAMYRDBJZGXIQ-KRWDZBQOSA-O |
| XLogP | 1.68 |
| TPSA | 28.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|