C20H26F6N3OS+ — CID 11861250
(2S)-N-[3,5-bis(trifluoromethyl)phenyl]-2-(2-morpholin-4-ium-4-ylethyl)piperidine-1-carbothioamide (PubChem CID 11861250) has the molecular formula C20H26F6N3OS+ and a molecular weight of 470.50 g/mol. Its IUPAC name is (2S)-N-[3,5-bis(trifluoromethyl)phenyl]-2-(2-morpholin-4-ium-4-ylethyl)piperidine-1-carbothioamide.
| Compound Name | (2S)-N-[3,5-bis(trifluoromethyl)phenyl]-2-(2-morpholin-4-ium-4-ylethyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 11861250 |
| Molecular Formula | C20H26F6N3OS+ |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | (2S)-N-[3,5-bis(trifluoromethyl)phenyl]-2-(2-morpholin-4-ium-4-ylethyl)piperidine-1-carbothioamide |
| SMILES | FC(F)(F)c1cc(NC(=S)N2CCCC[C@H]2CC[NH+]2CCOCC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H25F6N3OS/c21-19(22,23)14-11-15(20(24,25)26)13-16(12-14)27-18(31)29-5-2-1-3-17(29)4-6-28-7-9-30-10-8-28/h11-13,17H,1-10H2,(H,27,31)/p+1/t17-/m0/s1 |
| InChIKey | UVXSBFGZBVISCS-KRWDZBQOSA-O |
| XLogP | 3.58 |
| TPSA | 28.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|