C16H19F6N3S — CID 89376069
1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1R,2R)-2-(methylamino)cyclohexyl]thiourea (PubChem CID 89376069) has the molecular formula C16H19F6N3S and a molecular weight of 399.40 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1R,2R)-2-(methylamino)cyclohexyl]thiourea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1R,2R)-2-(methylamino)cyclohexyl]thiourea |
|---|---|
| PubChem CID | 89376069 |
| Molecular Formula | C16H19F6N3S |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1R,2R)-2-(methylamino)cyclohexyl]thiourea |
| SMILES | CN[C@@H]1CCCC[C@H]1NC(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H19F6N3S/c1-23-12-4-2-3-5-13(12)25-14(26)24-11-7-9(15(17,18)19)6-10(8-11)16(20,21)22/h6-8,12-13,23H,2-5H2,1H3,(H2,24,25,26)/t12-,13-/m1/s1 |
| InChIKey | CBFTXPBPYPAARR-CHWSQXEVSA-N |
| XLogP | 4.54 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|