C28H27F6N4OS+ — CID 102074713
1-benzyl-N-[(1R,2R)-2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]cyclohexyl]pyridin-1-ium-3-carboxamide (PubChem CID 102074713) has the molecular formula C28H27F6N4OS+ and a molecular weight of 581.61 g/mol. Its IUPAC name is 1-benzyl-N-[(1R,2R)-2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]cyclohexyl]pyridin-1-ium-3-carboxamide.
| Compound Name | 1-benzyl-N-[(1R,2R)-2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]cyclohexyl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 102074713 |
| Molecular Formula | C28H27F6N4OS+ |
| Molecular Weight | 581.61 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | 1-benzyl-N-[(1R,2R)-2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]cyclohexyl]pyridin-1-ium-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1NC(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc[n+](Cc2ccccc2)c1 |
| InChI | InChI=1S/C28H26F6N4OS/c29-27(30,31)20-13-21(28(32,33)34)15-22(14-20)35-26(40)37-24-11-5-4-10-23(24)36-25(39)19-9-6-12-38(17-19)16-18-7-2-1-3-8-18/h1-3,6-9,12-15,17,23-24H,4-5,10-11,16H2,(H2-,35,36,37,39,40)/p+1/t23-,24-/m1/s1 |
| InChIKey | XWUGENHNLLBGMB-DNQXCXABSA-O |
| XLogP | 6.09 |
| TPSA | 57.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.61 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|