C31H27ClF6N2O2 — CID 87304686
1-benzyl-N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropyl]pyridin-1-ium-3-carboxamide chloride (PubChem CID 87304686) has the molecular formula C31H27ClF6N2O2 and a molecular weight of 609.01 g/mol. Its IUPAC name is 1-benzyl-N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropyl]pyridin-1-ium-3-carboxamide chloride.
| Compound Name | 1-benzyl-N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropyl]pyridin-1-ium-3-carboxamide chloride |
|---|---|
| PubChem CID | 87304686 |
| Molecular Formula | C31H27ClF6N2O2 |
| Molecular Weight | 609.01 g/mol |
| Exact Mass | 608.17 |
| IUPAC Name | 1-benzyl-N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropyl]pyridin-1-ium-3-carboxamide chloride |
| SMILES | O=C(NCC(COCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1)c1ccc[n+](Cc2ccccc2)c1.[Cl-] |
| InChI | InChI=1S/C31H26F6N2O2.ClH/c32-30(33,34)27-14-23(15-28(16-27)31(35,36)37)20-41-21-26(24-10-5-2-6-11-24)17-38-29(40)25-12-7-13-39(19-25)18-22-8-3-1-4-9-22;/h1-16,19,26H,17-18,20-21H2;1H |
| InChIKey | MKSBYERDISUDMM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.01 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|