About [3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropyl]-phenylcarbamic acid
[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropyl]-phenylcarbamic acid (PubChem CID 87304832) has the molecular formula C25H21F6NO3
and a molecular weight of 497.44 g/mol. Its IUPAC name is [3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropyl]-phenylcarbamic acid.
Molecular Properties
| Compound Name | [3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropyl]-phenylcarbamic acid |
| PubChem CID | 87304832 |
| Molecular Formula | C25H21F6NO3 |
| Molecular Weight | 497.44 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | [3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropyl]-phenylcarbamic acid |
| SMILES | O=C(O)N(CC(COCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H21F6NO3/c26-24(27,28)20-11-17(12-21(13-20)25(29,30)31)15-35-16-19(18-7-3-1-4-8-18)14-32(23(33)34)22-9-5-2-6-10-22/h1-13,19H,14-16H2,(H,33,34) |
| InChIKey | WHWMDYGCBWOBNR-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.44 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropyl]-phenylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropyl]-phenylcarbamic acid?
The IUPAC name of [3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropyl]-phenylcarbamic acid (CID 87304832) is [3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropyl]-phenylcarbamic acid.
What is the SMILES notation for [3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropyl]-phenylcarbamic acid?
The canonical SMILES for [3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropyl]-phenylcarbamic acid is O=C(O)N(CC(COCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1)c1ccccc1.
What is the InChIKey of [3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropyl]-phenylcarbamic acid?
The InChIKey is WHWMDYGCBWOBNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21F6NO3/c26-24(27,28)20-11-17(12-21(13-20)25(29,30)31)15-35-16-19(18-7-3-1-4-8-18)14-32(23(33)34)22-9-5-2-6-10-22/h1-13,19H,14-16H2,(H,33,34).
What are the key properties of [3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropyl]-phenylcarbamic acid?
[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropyl]-phenylcarbamic acid has a molecular weight of 497.44 g/mol, XLogP of 7.21, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropyl]-phenylcarbamic acid is sourced from PubChem (CID 87304832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).