C24H18Cl2F6N2O2 — CID 87306390
N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropyl]-2,6-dichloropyridine-3-carboxamide (PubChem CID 87306390) has the molecular formula C24H18Cl2F6N2O2 and a molecular weight of 551.31 g/mol. Its IUPAC name is N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropyl]-2,6-dichloropyridine-3-carboxamide.
| Compound Name | N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropyl]-2,6-dichloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 87306390 |
| Molecular Formula | C24H18Cl2F6N2O2 |
| Molecular Weight | 551.31 g/mol |
| Exact Mass | 550.06 |
| IUPAC Name | N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropyl]-2,6-dichloropyridine-3-carboxamide |
| SMILES | O=C(NCC(COCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1)c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C24H18Cl2F6N2O2/c25-20-7-6-19(21(26)34-20)22(35)33-11-16(15-4-2-1-3-5-15)13-36-12-14-8-17(23(27,28)29)10-18(9-14)24(30,31)32/h1-10,16H,11-13H2,(H,33,35) |
| InChIKey | WZVROSJDXXEBKD-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.31 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|