C22H20F2N2O3 — CID 67196995
N-[3-[(3,5-difluorophenyl)methoxy]-2-phenylpropyl]-1-oxidopyridin-1-ium-4-carboxamide (PubChem CID 67196995) has the molecular formula C22H20F2N2O3 and a molecular weight of 398.41 g/mol. Its IUPAC name is N-[3-[(3,5-difluorophenyl)methoxy]-2-phenylpropyl]-1-oxidopyridin-1-ium-4-carboxamide.
| Compound Name | N-[3-[(3,5-difluorophenyl)methoxy]-2-phenylpropyl]-1-oxidopyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 67196995 |
| Molecular Formula | C22H20F2N2O3 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-[3-[(3,5-difluorophenyl)methoxy]-2-phenylpropyl]-1-oxidopyridin-1-ium-4-carboxamide |
| SMILES | O=C(NCC(COCc1cc(F)cc(F)c1)c1ccccc1)c1cc[n+]([O-])cc1 |
| InChI | InChI=1S/C22H20F2N2O3/c23-20-10-16(11-21(24)12-20)14-29-15-19(17-4-2-1-3-5-17)13-25-22(27)18-6-8-26(28)9-7-18/h1-12,19H,13-15H2,(H,25,27) |
| InChIKey | LUUPUZUXFWLNND-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 65.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|