C25H22F7N2O2+ — CID 87304802
N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-(4-fluorophenyl)propyl]-1-methylpyridin-1-ium-3-carboxamide (PubChem CID 87304802) has the molecular formula C25H22F7N2O2+ and a molecular weight of 515.45 g/mol. Its IUPAC name is N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-(4-fluorophenyl)propyl]-1-methylpyridin-1-ium-3-carboxamide.
| Compound Name | N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-(4-fluorophenyl)propyl]-1-methylpyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 87304802 |
| Molecular Formula | C25H22F7N2O2+ |
| Molecular Weight | 515.45 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-(4-fluorophenyl)propyl]-1-methylpyridin-1-ium-3-carboxamide |
| SMILES | C[n+]1cccc(C(=O)NCC(COCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C25H21F7N2O2/c1-34-8-2-3-18(13-34)23(35)33-12-19(17-4-6-22(26)7-5-17)15-36-14-16-9-20(24(27,28)29)11-21(10-16)25(30,31)32/h2-11,13,19H,12,14-15H2,1H3/p+1 |
| InChIKey | FMQAVDIGBCLQIA-UHFFFAOYSA-O |
| XLogP | 5.42 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.45 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|