C23H22Cl2N2O2 — CID 67196881
4-amino-N-[3-[(3,4-dichlorophenyl)methoxy]-2-phenylpropyl]benzamide (PubChem CID 67196881) has the molecular formula C23H22Cl2N2O2 and a molecular weight of 429.35 g/mol. Its IUPAC name is 4-amino-N-[3-[(3,4-dichlorophenyl)methoxy]-2-phenylpropyl]benzamide.
| Compound Name | 4-amino-N-[3-[(3,4-dichlorophenyl)methoxy]-2-phenylpropyl]benzamide |
|---|---|
| PubChem CID | 67196881 |
| Molecular Formula | C23H22Cl2N2O2 |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 4-amino-N-[3-[(3,4-dichlorophenyl)methoxy]-2-phenylpropyl]benzamide |
| SMILES | Nc1ccc(C(=O)NCC(COCc2ccc(Cl)c(Cl)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H22Cl2N2O2/c24-21-11-6-16(12-22(21)25)14-29-15-19(17-4-2-1-3-5-17)13-27-23(28)18-7-9-20(26)10-8-18/h1-12,19H,13-15,26H2,(H,27,28) |
| InChIKey | NRITXEILGCJBTG-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|