C18H14F6N2O2S — CID 74594694
2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]-3-phenylpropanoic acid (PubChem CID 74594694) has the molecular formula C18H14F6N2O2S and a molecular weight of 436.38 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]-3-phenylpropanoic acid.
| Compound Name | 2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 74594694 |
| Molecular Formula | C18H14F6N2O2S |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]-3-phenylpropanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)NC(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H14F6N2O2S/c19-17(20,21)11-7-12(18(22,23)24)9-13(8-11)25-16(29)26-14(15(27)28)6-10-4-2-1-3-5-10/h1-5,7-9,14H,6H2,(H,27,28)(H2,25,26,29) |
| InChIKey | PLACJHWXHVDDDB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|