C32H23F12N3S — CID 155445967
1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1R)-2-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-1,2-diphenylethyl]thiourea (PubChem CID 155445967) has the molecular formula C32H23F12N3S and a molecular weight of 709.60 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1R)-2-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-1,2-diphenylethyl]thiourea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1R)-2-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-1,2-diphenylethyl]thiourea |
|---|---|
| PubChem CID | 155445967 |
| Molecular Formula | C32H23F12N3S |
| Molecular Weight | 709.60 g/mol |
| Exact Mass | 709.14 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1R)-2-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-1,2-diphenylethyl]thiourea |
| SMILES | FC(F)(F)c1cc(CNC(c2ccccc2)[C@H](NC(=S)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H23F12N3S/c33-29(34,35)21-11-18(12-22(13-21)30(36,37)38)17-45-26(19-7-3-1-4-8-19)27(20-9-5-2-6-10-20)47-28(48)46-25-15-23(31(39,40)41)14-24(16-25)32(42,43)44/h1-16,26-27,45H,17H2,(H2,46,47,48)/t26?,27-/m1/s1 |
| InChIKey | ANSWXCIUSZPTDP-SSYAZFEXSA-N |
| XLogP | 10.32 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.60 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|