C22H23F6N3S — CID 102260541
1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1S)-1-phenyl-2-piperidin-1-ylethyl]thiourea (PubChem CID 102260541) has the molecular formula C22H23F6N3S and a molecular weight of 475.50 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1S)-1-phenyl-2-piperidin-1-ylethyl]thiourea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1S)-1-phenyl-2-piperidin-1-ylethyl]thiourea |
|---|---|
| PubChem CID | 102260541 |
| Molecular Formula | C22H23F6N3S |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1S)-1-phenyl-2-piperidin-1-ylethyl]thiourea |
| SMILES | FC(F)(F)c1cc(NC(=S)N[C@H](CN2CCCCC2)c2ccccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H23F6N3S/c23-21(24,25)16-11-17(22(26,27)28)13-18(12-16)29-20(32)30-19(15-7-3-1-4-8-15)14-31-9-5-2-6-10-31/h1,3-4,7-8,11-13,19H,2,5-6,9-10,14H2,(H2,29,30,32)/t19-/m1/s1 |
| InChIKey | FSZFSWZKPKYDMA-LJQANCHMSA-N |
| XLogP | 6.24 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|