C19H20F3N3O2 — CID 155953730
2-oxo-N-(1-phenyl-2-pyrrolidin-1-ylethyl)-5-(trifluoromethyl)-1H-pyridine-3-carboxamide (PubChem CID 155953730) has the molecular formula C19H20F3N3O2 and a molecular weight of 379.38 g/mol. Its IUPAC name is 2-oxo-N-(1-phenyl-2-pyrrolidin-1-ylethyl)-5-(trifluoromethyl)-1H-pyridine-3-carboxamide.
| Compound Name | 2-oxo-N-(1-phenyl-2-pyrrolidin-1-ylethyl)-5-(trifluoromethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155953730 |
| Molecular Formula | C19H20F3N3O2 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-oxo-N-(1-phenyl-2-pyrrolidin-1-ylethyl)-5-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| SMILES | O=C(NC(CN1CCCC1)c1ccccc1)c1cc(C(F)(F)F)c[nH]c1=O |
| InChI | InChI=1S/C19H20F3N3O2/c20-19(21,22)14-10-15(17(26)23-11-14)18(27)24-16(12-25-8-4-5-9-25)13-6-2-1-3-7-13/h1-3,6-7,10-11,16H,4-5,8-9,12H2,(H,23,26)(H,24,27) |
| InChIKey | OYXNEKXXROIDQA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |