C22H26N2O — CID 66685345
1-phenyl-N-(1-phenyl-2-pyrrolidin-1-ylethyl)cyclopropane-1-carboxamide (PubChem CID 66685345) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-phenyl-N-(1-phenyl-2-pyrrolidin-1-ylethyl)cyclopropane-1-carboxamide.
| Compound Name | 1-phenyl-N-(1-phenyl-2-pyrrolidin-1-ylethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 66685345 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 1-phenyl-N-(1-phenyl-2-pyrrolidin-1-ylethyl)cyclopropane-1-carboxamide |
| SMILES | O=C(NC(CN1CCCC1)c1ccccc1)C1(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H26N2O/c25-21(22(13-14-22)19-11-5-2-6-12-19)23-20(17-24-15-7-8-16-24)18-9-3-1-4-10-18/h1-6,9-12,20H,7-8,13-17H2,(H,23,25) |
| InChIKey | DYSQNBRTFGZWCD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |