C23H29ClN2O4S — CID 87105945
[4-[1-[[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]carbamoyl]cyclopropyl]phenyl] methanesulfonate;hydrochloride (PubChem CID 87105945) has the molecular formula C23H29ClN2O4S and a molecular weight of 465.02 g/mol. Its IUPAC name is [4-[1-[[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]carbamoyl]cyclopropyl]phenyl] methanesulfonate;hydrochloride.
| Compound Name | [4-[1-[[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]carbamoyl]cyclopropyl]phenyl] methanesulfonate;hydrochloride |
|---|---|
| PubChem CID | 87105945 |
| Molecular Formula | C23H29ClN2O4S |
| Molecular Weight | 465.02 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | [4-[1-[[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]carbamoyl]cyclopropyl]phenyl] methanesulfonate;hydrochloride |
| SMILES | CS(=O)(=O)Oc1ccc(C2(C(=O)N[C@H](CN3CCCC3)c3ccccc3)CC2)cc1.Cl |
| InChI | InChI=1S/C23H28N2O4S.ClH/c1-30(27,28)29-20-11-9-19(10-12-20)23(13-14-23)22(26)24-21(17-25-15-5-6-16-25)18-7-3-2-4-8-18;/h2-4,7-12,21H,5-6,13-17H2,1H3,(H,24,26);1H/t21-;/m1./s1 |
| InChIKey | RGBQFDZBYBEEEH-ZMBIFBSDSA-N |
| XLogP | 3.43 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.02 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|