C29H32N2O2 — CID 66685367
1-(3-phenylmethoxyphenyl)-N-(1-phenyl-2-pyrrolidin-1-ylethyl)cyclopropane-1-carboxamide (PubChem CID 66685367) has the molecular formula C29H32N2O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is 1-(3-phenylmethoxyphenyl)-N-(1-phenyl-2-pyrrolidin-1-ylethyl)cyclopropane-1-carboxamide.
| Compound Name | 1-(3-phenylmethoxyphenyl)-N-(1-phenyl-2-pyrrolidin-1-ylethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 66685367 |
| Molecular Formula | C29H32N2O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 1-(3-phenylmethoxyphenyl)-N-(1-phenyl-2-pyrrolidin-1-ylethyl)cyclopropane-1-carboxamide |
| SMILES | O=C(NC(CN1CCCC1)c1ccccc1)C1(c2cccc(OCc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C29H32N2O2/c32-28(30-27(21-31-18-7-8-19-31)24-12-5-2-6-13-24)29(16-17-29)25-14-9-15-26(20-25)33-22-23-10-3-1-4-11-23/h1-6,9-15,20,27H,7-8,16-19,21-22H2,(H,30,32) |
| InChIKey | FBYOKGDJBPRUII-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |