C25H32N2O — CID 66692251
1-phenyl-N-[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]cyclohexane-1-carboxamide (PubChem CID 66692251) has the molecular formula C25H32N2O and a molecular weight of 376.54 g/mol. Its IUPAC name is 1-phenyl-N-[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]cyclohexane-1-carboxamide.
| Compound Name | 1-phenyl-N-[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 66692251 |
| Molecular Formula | C25H32N2O |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | 1-phenyl-N-[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]cyclohexane-1-carboxamide |
| SMILES | O=C(N[C@H](CN1CCCC1)c1ccccc1)C1(c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C25H32N2O/c28-24(25(16-8-3-9-17-25)22-14-6-2-7-15-22)26-23(20-27-18-10-11-19-27)21-12-4-1-5-13-21/h1-2,4-7,12-15,23H,3,8-11,16-20H2,(H,26,28)/t23-/m1/s1 |
| InChIKey | KHJBKLUQZOBONB-HSZRJFAPSA-N |
| XLogP | 4.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |