C18H16F6N2OS — CID 101377090
1-[3,5-bis(trifluoromethyl)phenyl]-3-[(2S)-1-hydroxy-3-phenylpropan-2-yl]thiourea (PubChem CID 101377090) has the molecular formula C18H16F6N2OS and a molecular weight of 422.39 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(2S)-1-hydroxy-3-phenylpropan-2-yl]thiourea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(2S)-1-hydroxy-3-phenylpropan-2-yl]thiourea |
|---|---|
| PubChem CID | 101377090 |
| Molecular Formula | C18H16F6N2OS |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(2S)-1-hydroxy-3-phenylpropan-2-yl]thiourea |
| SMILES | OC[C@H](Cc1ccccc1)NC(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H16F6N2OS/c19-17(20,21)12-7-13(18(22,23)24)9-14(8-12)25-16(28)26-15(10-27)6-11-4-2-1-3-5-11/h1-5,7-9,15,27H,6,10H2,(H2,25,26,28)/t15-/m0/s1 |
| InChIKey | QYFHDBMJBUUUIG-HNNXBMFYSA-N |
| XLogP | 4.61 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|