C18H25F6N3S — CID 89493468
1-[3,5-bis(trifluoromethyl)phenyl]-3-[(2R)-1-(dimethylamino)-5-methylhexan-2-yl]thiourea (PubChem CID 89493468) has the molecular formula C18H25F6N3S and a molecular weight of 429.47 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(2R)-1-(dimethylamino)-5-methylhexan-2-yl]thiourea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(2R)-1-(dimethylamino)-5-methylhexan-2-yl]thiourea |
|---|---|
| PubChem CID | 89493468 |
| Molecular Formula | C18H25F6N3S |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(2R)-1-(dimethylamino)-5-methylhexan-2-yl]thiourea |
| SMILES | CC(C)CC[C@H](CN(C)C)NC(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H25F6N3S/c1-11(2)5-6-14(10-27(3)4)25-16(28)26-15-8-12(17(19,20)21)7-13(9-15)18(22,23)24/h7-9,11,14H,5-6,10H2,1-4H3,(H2,25,26,28)/t14-/m1/s1 |
| InChIKey | LLBSEHFZLIEHJN-CQSZACIVSA-N |
| XLogP | 5.38 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|