C24H27F6N3OS — CID 135331948
(2S)-2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]-N,3-dimethyl-N-[(1S)-1-phenylpropyl]butanamide (PubChem CID 135331948) has the molecular formula C24H27F6N3OS and a molecular weight of 519.56 g/mol. Its IUPAC name is (2S)-2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]-N,3-dimethyl-N-[(1S)-1-phenylpropyl]butanamide.
| Compound Name | (2S)-2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]-N,3-dimethyl-N-[(1S)-1-phenylpropyl]butanamide |
|---|---|
| PubChem CID | 135331948 |
| Molecular Formula | C24H27F6N3OS |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | (2S)-2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]-N,3-dimethyl-N-[(1S)-1-phenylpropyl]butanamide |
| SMILES | CC[C@@H](c1ccccc1)N(C)C(=O)[C@@H](NC(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(C)C |
| InChI | InChI=1S/C24H27F6N3OS/c1-5-19(15-9-7-6-8-10-15)33(4)21(34)20(14(2)3)32-22(35)31-18-12-16(23(25,26)27)11-17(13-18)24(28,29)30/h6-14,19-20H,5H2,1-4H3,(H2,31,32,35)/t19-,20-/m0/s1 |
| InChIKey | DKUSJJNDTXDYJS-PMACEKPBSA-N |
| XLogP | 6.64 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|