C27H27F6N2PS — CID 102503068
1-[3,5-bis(trifluoromethyl)phenyl]-3-[(2S,3S)-1-diphenylphosphanyl-3-methylpentan-2-yl]thiourea (PubChem CID 102503068) has the molecular formula C27H27F6N2PS and a molecular weight of 556.56 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(2S,3S)-1-diphenylphosphanyl-3-methylpentan-2-yl]thiourea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(2S,3S)-1-diphenylphosphanyl-3-methylpentan-2-yl]thiourea |
|---|---|
| PubChem CID | 102503068 |
| Molecular Formula | C27H27F6N2PS |
| Molecular Weight | 556.56 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(2S,3S)-1-diphenylphosphanyl-3-methylpentan-2-yl]thiourea |
| SMILES | CC[C@H](C)[C@@H](CP(c1ccccc1)c1ccccc1)NC(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H27F6N2PS/c1-3-18(2)24(17-36(22-10-6-4-7-11-22)23-12-8-5-9-13-23)35-25(37)34-21-15-19(26(28,29)30)14-20(16-21)27(31,32)33/h4-16,18,24H,3,17H2,1-2H3,(H2,34,35,37)/t18-,24+/m0/s1 |
| InChIKey | KILYNYXYTSWIFC-MHECFPHRSA-N |
| XLogP | 7.56 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.56 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|