C25H28FN2PS — CID 146012586
1-[(2S,3S)-1-diphenylphosphanyl-3-methylpentan-2-yl]-3-(4-fluorophenyl)thiourea (PubChem CID 146012586) has the molecular formula C25H28FN2PS and a molecular weight of 438.55 g/mol. Its IUPAC name is 1-[(2S,3S)-1-diphenylphosphanyl-3-methylpentan-2-yl]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[(2S,3S)-1-diphenylphosphanyl-3-methylpentan-2-yl]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 146012586 |
| Molecular Formula | C25H28FN2PS |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 1-[(2S,3S)-1-diphenylphosphanyl-3-methylpentan-2-yl]-3-(4-fluorophenyl)thiourea |
| SMILES | CC[C@H](C)[C@@H](CP(c1ccccc1)c1ccccc1)NC(=S)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C25H28FN2PS/c1-3-19(2)24(28-25(30)27-21-16-14-20(26)15-17-21)18-29(22-10-6-4-7-11-22)23-12-8-5-9-13-23/h4-17,19,24H,3,18H2,1-2H3,(H2,27,28,30)/t19-,24+/m0/s1 |
| InChIKey | FNCBPOQHSGPBDV-YADARESESA-N |
| XLogP | 5.66 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|