C13H17N2O2S- — CID 7338350
(2S,3S)-3-methyl-2-(phenylcarbamothioylamino)pentanoate (PubChem CID 7338350) has the molecular formula C13H17N2O2S- and a molecular weight of 265.36 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-(phenylcarbamothioylamino)pentanoate.
| Compound Name | (2S,3S)-3-methyl-2-(phenylcarbamothioylamino)pentanoate |
|---|---|
| PubChem CID | 7338350 |
| Molecular Formula | C13H17N2O2S- |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | (2S,3S)-3-methyl-2-(phenylcarbamothioylamino)pentanoate |
| SMILES | CC[C@H](C)[C@H](NC(=S)Nc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C13H18N2O2S/c1-3-9(2)11(12(16)17)15-13(18)14-10-7-5-4-6-8-10/h4-9,11H,3H2,1-2H3,(H,16,17)(H2,14,15,18)/p-1/t9-,11-/m0/s1 |
| InChIKey | KRKBSIJUCVXTLT-ONGXEEELSA-M |
| XLogP | 1.14 |
| TPSA | 64.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|