C14H23N2O3PS — CID 88820205
butan-2-yloxy-[1-(phenylcarbamothioylamino)propyl]phosphinic acid (PubChem CID 88820205) has the molecular formula C14H23N2O3PS and a molecular weight of 330.39 g/mol. Its IUPAC name is butan-2-yloxy-[1-(phenylcarbamothioylamino)propyl]phosphinic acid.
| Compound Name | butan-2-yloxy-[1-(phenylcarbamothioylamino)propyl]phosphinic acid |
|---|---|
| PubChem CID | 88820205 |
| Molecular Formula | C14H23N2O3PS |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | butan-2-yloxy-[1-(phenylcarbamothioylamino)propyl]phosphinic acid |
| SMILES | CCC(C)OP(=O)(O)C(CC)NC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C14H23N2O3PS/c1-4-11(3)19-20(17,18)13(5-2)16-14(21)15-12-9-7-6-8-10-12/h6-11,13H,4-5H2,1-3H3,(H,17,18)(H2,15,16,21) |
| InChIKey | MDUYGWJCTAALJN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|