C18H23N2OPS3 — CID 2784033
1-[bis(ethylsulfanyl)phosphoryl-phenylmethyl]-3-phenylthiourea (PubChem CID 2784033) has the molecular formula C18H23N2OPS3 and a molecular weight of 410.57 g/mol. Its IUPAC name is 1-[bis(ethylsulfanyl)phosphoryl-phenylmethyl]-3-phenylthiourea.
| Compound Name | 1-[bis(ethylsulfanyl)phosphoryl-phenylmethyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 2784033 |
| Molecular Formula | C18H23N2OPS3 |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 1-[bis(ethylsulfanyl)phosphoryl-phenylmethyl]-3-phenylthiourea |
| SMILES | CCSP(=O)(SCC)C(NC(=S)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H23N2OPS3/c1-3-24-22(21,25-4-2)17(15-11-7-5-8-12-15)20-18(23)19-16-13-9-6-10-14-16/h5-14,17H,3-4H2,1-2H3,(H2,19,20,23) |
| InChIKey | BATXQNHGOYJKGI-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|