C12H16N2O2S2 — CID 3037816
(2R)-3-ethylsulfanyl-2-(phenylcarbamothioylamino)propanoic acid (PubChem CID 3037816) has the molecular formula C12H16N2O2S2 and a molecular weight of 284.41 g/mol. Its IUPAC name is (2R)-3-ethylsulfanyl-2-(phenylcarbamothioylamino)propanoic acid.
| Compound Name | (2R)-3-ethylsulfanyl-2-(phenylcarbamothioylamino)propanoic acid |
|---|---|
| PubChem CID | 3037816 |
| Molecular Formula | C12H16N2O2S2 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | (2R)-3-ethylsulfanyl-2-(phenylcarbamothioylamino)propanoic acid |
| SMILES | CCSC[C@H](NC(=S)Nc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H16N2O2S2/c1-2-18-8-10(11(15)16)14-12(17)13-9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3,(H,15,16)(H2,13,14,17)/t10-/m0/s1 |
| InChIKey | VXBLCJFXZZAMPK-JTQLQIEISA-N |
| XLogP | 2.18 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|