C28H26F6N4OS — CID 56601826
(2S)-N-[(1R,2R)-2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]-1,2-diphenylethyl]pyrrolidine-2-carboxamide (PubChem CID 56601826) has the molecular formula C28H26F6N4OS and a molecular weight of 580.60 g/mol. Its IUPAC name is (2S)-N-[(1R,2R)-2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]-1,2-diphenylethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(1R,2R)-2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]-1,2-diphenylethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 56601826 |
| Molecular Formula | C28H26F6N4OS |
| Molecular Weight | 580.60 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | (2S)-N-[(1R,2R)-2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]-1,2-diphenylethyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(N[C@H](c1ccccc1)[C@H](NC(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C28H26F6N4OS/c29-27(30,31)19-14-20(28(32,33)34)16-21(15-19)36-26(40)38-24(18-10-5-2-6-11-18)23(17-8-3-1-4-9-17)37-25(39)22-12-7-13-35-22/h1-6,8-11,14-16,22-24,35H,7,12-13H2,(H,37,39)(H2,36,38,40)/t22-,23+,24+/m0/s1 |
| InChIKey | OUSAHIBEBBVYNL-RBZQAINGSA-N |
| XLogP | 6.36 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.60 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|