C12H12BrF3N2O — CID 65490023
N-[3-bromo-5-(trifluoromethyl)phenyl]pyrrolidine-2-carboxamide (PubChem CID 65490023) has the molecular formula C12H12BrF3N2O and a molecular weight of 337.14 g/mol. Its IUPAC name is N-[3-bromo-5-(trifluoromethyl)phenyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[3-bromo-5-(trifluoromethyl)phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 65490023 |
| Molecular Formula | C12H12BrF3N2O |
| Molecular Weight | 337.14 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | N-[3-bromo-5-(trifluoromethyl)phenyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1cc(Br)cc(C(F)(F)F)c1)C1CCCN1 |
| InChI | InChI=1S/C12H12BrF3N2O/c13-8-4-7(12(14,15)16)5-9(6-8)18-11(19)10-2-1-3-17-10/h4-6,10,17H,1-3H2,(H,18,19) |
| InChIKey | OHJNTKXRUHVSII-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.14 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |