C26H19F9N2O2 — CID 170288135
2-benzyl-N-[3,5-bis(trifluoromethyl)phenyl]-N'-[3-methyl-5-(trifluoromethyl)phenyl]propanediamide (PubChem CID 170288135) has the molecular formula C26H19F9N2O2 and a molecular weight of 562.43 g/mol. Its IUPAC name is 2-benzyl-N-[3,5-bis(trifluoromethyl)phenyl]-N'-[3-methyl-5-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | 2-benzyl-N-[3,5-bis(trifluoromethyl)phenyl]-N'-[3-methyl-5-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 170288135 |
| Molecular Formula | C26H19F9N2O2 |
| Molecular Weight | 562.43 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | 2-benzyl-N-[3,5-bis(trifluoromethyl)phenyl]-N'-[3-methyl-5-(trifluoromethyl)phenyl]propanediamide |
| SMILES | Cc1cc(NC(=O)C(Cc2ccccc2)C(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H19F9N2O2/c1-14-7-16(24(27,28)29)11-19(8-14)36-22(38)21(9-15-5-3-2-4-6-15)23(39)37-20-12-17(25(30,31)32)10-18(13-20)26(33,34)35/h2-8,10-13,21H,9H2,1H3,(H,36,38)(H,37,39) |
| InChIKey | HLTQAXMPIFRZSY-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.43 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|