C19H16F6N2O2 — CID 100722444
N-[3,5-bis(trifluoromethyl)phenyl]-N'-(2-phenylpropan-2-yl)oxamide (PubChem CID 100722444) has the molecular formula C19H16F6N2O2 and a molecular weight of 418.34 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-N'-(2-phenylpropan-2-yl)oxamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-N'-(2-phenylpropan-2-yl)oxamide |
|---|---|
| PubChem CID | 100722444 |
| Molecular Formula | C19H16F6N2O2 |
| Molecular Weight | 418.34 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-N'-(2-phenylpropan-2-yl)oxamide |
| SMILES | CC(C)(NC(=O)C(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C19H16F6N2O2/c1-17(2,11-6-4-3-5-7-11)27-16(29)15(28)26-14-9-12(18(20,21)22)8-13(10-14)19(23,24)25/h3-10H,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | CHHFCGZNCNXLNW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.34 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|